C35H52O3 — CID 89252908
[2-[1-[2-hydroxy-3-methyl-5-(2-methylpentan-2-yl)phenyl]ethyl]-6-(2-methylbutan-2-yl)-4-(2-methylpentan-2-yl)phenyl] prop-2-enoate (PubChem CID 89252908) has the molecular formula C35H52O3 and a molecular weight of 520.80 g/mol. Its IUPAC name is [2-[1-[2-hydroxy-3-methyl-5-(2-methylpentan-2-yl)phenyl]ethyl]-6-(2-methylbutan-2-yl)-4-(2-methylpentan-2-yl)phenyl] prop-2-enoate.
| Compound Name | [2-[1-[2-hydroxy-3-methyl-5-(2-methylpentan-2-yl)phenyl]ethyl]-6-(2-methylbutan-2-yl)-4-(2-methylpentan-2-yl)phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 89252908 |
| Molecular Formula | C35H52O3 |
| Molecular Weight | 520.80 g/mol |
| Exact Mass | 520.39 |
| IUPAC Name | [2-[1-[2-hydroxy-3-methyl-5-(2-methylpentan-2-yl)phenyl]ethyl]-6-(2-methylbutan-2-yl)-4-(2-methylpentan-2-yl)phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1c(C(C)c2cc(C(C)(C)CCC)cc(C)c2O)cc(C(C)(C)CCC)cc1C(C)(C)CC |
| InChI | InChI=1S/C35H52O3/c1-13-17-34(9,10)25-19-23(5)31(37)27(20-25)24(6)28-21-26(35(11,12)18-14-2)22-29(33(7,8)16-4)32(28)38-30(36)15-3/h15,19-22,24,37H,3,13-14,16-18H2,1-2,4-12H3 |
| InChIKey | DPAOCDQLXQNKRU-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.80 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|