C17H27F2NO — CID 115406049
2,6-ditert-butyl-4-[(2,2-difluoroethylamino)methyl]phenol (PubChem CID 115406049) has the molecular formula C17H27F2NO and a molecular weight of 299.41 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(2,2-difluoroethylamino)methyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[(2,2-difluoroethylamino)methyl]phenol |
|---|---|
| PubChem CID | 115406049 |
| Molecular Formula | C17H27F2NO |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | 2,6-ditert-butyl-4-[(2,2-difluoroethylamino)methyl]phenol |
| SMILES | CC(C)(C)c1cc(CNCC(F)F)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C17H27F2NO/c1-16(2,3)12-7-11(9-20-10-14(18)19)8-13(15(12)21)17(4,5)6/h7-8,14,20-21H,9-10H2,1-6H3 |
| InChIKey | BZFJICVHCRCCKD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |