C9H10Cl2F2N2 — CID 82841143
2,6-dichloro-4-[(2,2-difluoroethylamino)methyl]aniline (PubChem CID 82841143) has the molecular formula C9H10Cl2F2N2 and a molecular weight of 255.09 g/mol. Its IUPAC name is 2,6-dichloro-4-[(2,2-difluoroethylamino)methyl]aniline.
| Compound Name | 2,6-dichloro-4-[(2,2-difluoroethylamino)methyl]aniline |
|---|---|
| PubChem CID | 82841143 |
| Molecular Formula | C9H10Cl2F2N2 |
| Molecular Weight | 255.09 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | 2,6-dichloro-4-[(2,2-difluoroethylamino)methyl]aniline |
| SMILES | Nc1c(Cl)cc(CNCC(F)F)cc1Cl |
| InChI | InChI=1S/C9H10Cl2F2N2/c10-6-1-5(2-7(11)9(6)14)3-15-4-8(12)13/h1-2,8,15H,3-4,14H2 |
| InChIKey | IVNQKWGDKHABLI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.09 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|