C11H14ClF2N — CID 87065341
N-[(4-chloro-3-ethylphenyl)methyl]-2,2-difluoroethanamine (PubChem CID 87065341) has the molecular formula C11H14ClF2N and a molecular weight of 233.69 g/mol. Its IUPAC name is N-[(4-chloro-3-ethylphenyl)methyl]-2,2-difluoroethanamine.
| Compound Name | N-[(4-chloro-3-ethylphenyl)methyl]-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 87065341 |
| Molecular Formula | C11H14ClF2N |
| Molecular Weight | 233.69 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | N-[(4-chloro-3-ethylphenyl)methyl]-2,2-difluoroethanamine |
| SMILES | CCc1cc(CNCC(F)F)ccc1Cl |
| InChI | InChI=1S/C11H14ClF2N/c1-2-9-5-8(3-4-10(9)12)6-15-7-11(13)14/h3-5,11,15H,2,6-7H2,1H3 |
| InChIKey | BGZDCORQRVTDQE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.69 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |