C12H17ClFN — CID 102615662
N-[(2-chloro-5-fluorophenyl)methyl]-2-methylbutan-1-amine (PubChem CID 102615662) has the molecular formula C12H17ClFN and a molecular weight of 229.73 g/mol. Its IUPAC name is N-[(2-chloro-5-fluorophenyl)methyl]-2-methylbutan-1-amine.
| Compound Name | N-[(2-chloro-5-fluorophenyl)methyl]-2-methylbutan-1-amine |
|---|---|
| PubChem CID | 102615662 |
| Molecular Formula | C12H17ClFN |
| Molecular Weight | 229.73 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | N-[(2-chloro-5-fluorophenyl)methyl]-2-methylbutan-1-amine |
| SMILES | CCC(C)CNCc1cc(F)ccc1Cl |
| InChI | InChI=1S/C12H17ClFN/c1-3-9(2)7-15-8-10-6-11(14)4-5-12(10)13/h4-6,9,15H,3,7-8H2,1-2H3 |
| InChIKey | BMVNBYQPFOWLIA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.73 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |