C10H9ClFN — CID 102615324
N-[(2-chloro-5-fluorophenyl)methyl]prop-2-yn-1-amine (PubChem CID 102615324) has the molecular formula C10H9ClFN and a molecular weight of 197.64 g/mol. Its IUPAC name is N-[(2-chloro-5-fluorophenyl)methyl]prop-2-yn-1-amine.
| Compound Name | N-[(2-chloro-5-fluorophenyl)methyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 102615324 |
| Molecular Formula | C10H9ClFN |
| Molecular Weight | 197.64 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | N-[(2-chloro-5-fluorophenyl)methyl]prop-2-yn-1-amine |
| SMILES | C#CCNCc1cc(F)ccc1Cl |
| InChI | InChI=1S/C10H9ClFN/c1-2-5-13-7-8-6-9(12)3-4-10(8)11/h1,3-4,6,13H,5,7H2 |
| InChIKey | YFYHQKRYSQWBGA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.64 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|