C21H29ClFNO — CID 139761952
2,6-ditert-butyl-4-[(4-fluorophenyl)methylamino]phenol;hydrochloride (PubChem CID 139761952) has the molecular formula C21H29ClFNO and a molecular weight of 365.92 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(4-fluorophenyl)methylamino]phenol;hydrochloride.
| Compound Name | 2,6-ditert-butyl-4-[(4-fluorophenyl)methylamino]phenol;hydrochloride |
|---|---|
| PubChem CID | 139761952 |
| Molecular Formula | C21H29ClFNO |
| Molecular Weight | 365.92 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 2,6-ditert-butyl-4-[(4-fluorophenyl)methylamino]phenol;hydrochloride |
| SMILES | CC(C)(C)c1cc(NCc2ccc(F)cc2)cc(C(C)(C)C)c1O.Cl |
| InChI | InChI=1S/C21H28FNO.ClH/c1-20(2,3)17-11-16(12-18(19(17)24)21(4,5)6)23-13-14-7-9-15(22)10-8-14;/h7-12,23-24H,13H2,1-6H3;1H |
| InChIKey | QMOJWONKWIBRRO-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.92 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|