C21H29NO — CID 175424672
4-[(3,5-ditert-butylanilino)methyl]phenol (PubChem CID 175424672) has the molecular formula C21H29NO and a molecular weight of 311.47 g/mol. Its IUPAC name is 4-[(3,5-ditert-butylanilino)methyl]phenol.
| Compound Name | 4-[(3,5-ditert-butylanilino)methyl]phenol |
|---|---|
| PubChem CID | 175424672 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 4-[(3,5-ditert-butylanilino)methyl]phenol |
| SMILES | CC(C)(C)c1cc(NCc2ccc(O)cc2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C21H29NO/c1-20(2,3)16-11-17(21(4,5)6)13-18(12-16)22-14-15-7-9-19(23)10-8-15/h7-13,22-23H,14H2,1-6H3 |
| InChIKey | XQSQTGRQPPLRRW-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |