C18H21FN2O — CID 112982446
N-[4-[(4-fluorophenyl)methylamino]phenyl]-2,2-dimethylpropanamide (PubChem CID 112982446) has the molecular formula C18H21FN2O and a molecular weight of 300.38 g/mol. Its IUPAC name is N-[4-[(4-fluorophenyl)methylamino]phenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-[(4-fluorophenyl)methylamino]phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 112982446 |
| Molecular Formula | C18H21FN2O |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N-[4-[(4-fluorophenyl)methylamino]phenyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1ccc(NCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H21FN2O/c1-18(2,3)17(22)21-16-10-8-15(9-11-16)20-12-13-4-6-14(19)7-5-13/h4-11,20H,12H2,1-3H3,(H,21,22) |
| InChIKey | XQKCCTMNXAHXSE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |