C20H26N2O — CID 88575602
4-[(4-aminoanilino)methyl]-2-tert-butyl-6-prop-1-en-2-ylphenol (PubChem CID 88575602) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is 4-[(4-aminoanilino)methyl]-2-tert-butyl-6-prop-1-en-2-ylphenol.
| Compound Name | 4-[(4-aminoanilino)methyl]-2-tert-butyl-6-prop-1-en-2-ylphenol |
|---|---|
| PubChem CID | 88575602 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 4-[(4-aminoanilino)methyl]-2-tert-butyl-6-prop-1-en-2-ylphenol |
| SMILES | C=C(C)c1cc(CNc2ccc(N)cc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C20H26N2O/c1-13(2)17-10-14(11-18(19(17)23)20(3,4)5)12-22-16-8-6-15(21)7-9-16/h6-11,22-23H,1,12,21H2,2-5H3 |
| InChIKey | DPEPTSCJLFCDJX-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|