C35H51N3 — CID 143284917
1-N-[(4-amino-3,5-ditert-butylphenyl)methyl]-4-N-(4-octylphenyl)benzene-1,4-diamine (PubChem CID 143284917) has the molecular formula C35H51N3 and a molecular weight of 513.81 g/mol. Its IUPAC name is 1-N-[(4-amino-3,5-ditert-butylphenyl)methyl]-4-N-(4-octylphenyl)benzene-1,4-diamine.
| Compound Name | 1-N-[(4-amino-3,5-ditert-butylphenyl)methyl]-4-N-(4-octylphenyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 143284917 |
| Molecular Formula | C35H51N3 |
| Molecular Weight | 513.81 g/mol |
| Exact Mass | 513.41 |
| IUPAC Name | 1-N-[(4-amino-3,5-ditert-butylphenyl)methyl]-4-N-(4-octylphenyl)benzene-1,4-diamine |
| SMILES | CCCCCCCCc1ccc(Nc2ccc(NCc3cc(C(C)(C)C)c(N)c(C(C)(C)C)c3)cc2)cc1 |
| InChI | InChI=1S/C35H51N3/c1-8-9-10-11-12-13-14-26-15-17-29(18-16-26)38-30-21-19-28(20-22-30)37-25-27-23-31(34(2,3)4)33(36)32(24-27)35(5,6)7/h15-24,37-38H,8-14,25,36H2,1-7H3 |
| InChIKey | ABQMZRRQWOMVJC-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.81 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|