C26H41NO3Si — CID 162328467
acetic acid;4-[2-[(4-aminophenyl)-dimethylsilyl]ethyl]-2,6-ditert-butylphenol (PubChem CID 162328467) has the molecular formula C26H41NO3Si and a molecular weight of 443.70 g/mol. Its IUPAC name is acetic acid;4-[2-[(4-aminophenyl)-dimethylsilyl]ethyl]-2,6-ditert-butylphenol.
| Compound Name | acetic acid;4-[2-[(4-aminophenyl)-dimethylsilyl]ethyl]-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 162328467 |
| Molecular Formula | C26H41NO3Si |
| Molecular Weight | 443.70 g/mol |
| Exact Mass | 443.29 |
| IUPAC Name | acetic acid;4-[2-[(4-aminophenyl)-dimethylsilyl]ethyl]-2,6-ditert-butylphenol |
| SMILES | CC(=O)O.CC(C)(C)c1cc(CC[Si](C)(C)c2ccc(N)cc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C24H37NOSi.C2H4O2/c1-23(2,3)20-15-17(16-21(22(20)26)24(4,5)6)13-14-27(7,8)19-11-9-18(25)10-12-19;1-2(3)4/h9-12,15-16,26H,13-14,25H2,1-8H3;1H3,(H,3,4) |
| InChIKey | RKBGISZZHODGGF-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.70 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|