About 4-[[(4-aminophenyl)-dimethylsilyl]methylsulfanyl]-2,5-ditert-butylphenol
4-[[(4-aminophenyl)-dimethylsilyl]methylsulfanyl]-2,5-ditert-butylphenol (PubChem CID 19971913) has the molecular formula C23H35NOSSi
and a molecular weight of 401.69 g/mol. Its IUPAC name is 4-[[(4-aminophenyl)-dimethylsilyl]methylsulfanyl]-2,5-ditert-butylphenol.
Molecular Properties
| Compound Name | 4-[[(4-aminophenyl)-dimethylsilyl]methylsulfanyl]-2,5-ditert-butylphenol |
| PubChem CID | 19971913 |
| Molecular Formula | C23H35NOSSi |
| Molecular Weight | 401.69 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 4-[[(4-aminophenyl)-dimethylsilyl]methylsulfanyl]-2,5-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(SC[Si](C)(C)c2ccc(N)cc2)c(C(C)(C)C)cc1O |
| InChI | InChI=1S/C23H35NOSSi/c1-22(2,3)18-14-21(19(13-20(18)25)23(4,5)6)26-15-27(7,8)17-11-9-16(24)10-12-17/h9-14,25H,15,24H2,1-8H3 |
| InChIKey | QVAWVGCVZIWGMZ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.69 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(4-aminophenyl)-dimethylsilyl]methylsulfanyl]-2,5-ditert-butylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(4-aminophenyl)-dimethylsilyl]methylsulfanyl]-2,5-ditert-butylphenol?
The IUPAC name of 4-[[(4-aminophenyl)-dimethylsilyl]methylsulfanyl]-2,5-ditert-butylphenol (CID 19971913) is 4-[[(4-aminophenyl)-dimethylsilyl]methylsulfanyl]-2,5-ditert-butylphenol.
What is the SMILES notation for 4-[[(4-aminophenyl)-dimethylsilyl]methylsulfanyl]-2,5-ditert-butylphenol?
The canonical SMILES for 4-[[(4-aminophenyl)-dimethylsilyl]methylsulfanyl]-2,5-ditert-butylphenol is CC(C)(C)c1cc(SC[Si](C)(C)c2ccc(N)cc2)c(C(C)(C)C)cc1O.
What is the InChIKey of 4-[[(4-aminophenyl)-dimethylsilyl]methylsulfanyl]-2,5-ditert-butylphenol?
The InChIKey is QVAWVGCVZIWGMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H35NOSSi/c1-22(2,3)18-14-21(19(13-20(18)25)23(4,5)6)26-15-27(7,8)17-11-9-16(24)10-12-17/h9-14,25H,15,24H2,1-8H3.
What are the key properties of 4-[[(4-aminophenyl)-dimethylsilyl]methylsulfanyl]-2,5-ditert-butylphenol?
4-[[(4-aminophenyl)-dimethylsilyl]methylsulfanyl]-2,5-ditert-butylphenol has a molecular weight of 401.69 g/mol, XLogP of 5.82, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(4-aminophenyl)-dimethylsilyl]methylsulfanyl]-2,5-ditert-butylphenol is sourced from PubChem (CID 19971913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).