C23H35NOSSi — CID 19971913
4-[[(4-aminophenyl)-dimethylsilyl]methylsulfanyl]-2,5-ditert-butylphenol (PubChem CID 19971913) has the molecular formula C23H35NOSSi and a molecular weight of 401.69 g/mol. Its IUPAC name is 4-[[(4-aminophenyl)-dimethylsilyl]methylsulfanyl]-2,5-ditert-butylphenol.
| Compound Name | 4-[[(4-aminophenyl)-dimethylsilyl]methylsulfanyl]-2,5-ditert-butylphenol |
|---|---|
| PubChem CID | 19971913 |
| Molecular Formula | C23H35NOSSi |
| Molecular Weight | 401.69 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 4-[[(4-aminophenyl)-dimethylsilyl]methylsulfanyl]-2,5-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(SC[Si](C)(C)c2ccc(N)cc2)c(C(C)(C)C)cc1O |
| InChI | InChI=1S/C23H35NOSSi/c1-22(2,3)18-14-21(19(13-20(18)25)23(4,5)6)26-15-27(7,8)17-11-9-16(24)10-12-17/h9-14,25H,15,24H2,1-8H3 |
| InChIKey | QVAWVGCVZIWGMZ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.69 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|