C18H30O2 — CID 141276702
2-tert-butyl-5-(2-ethyl-3,3-dimethylbutyl)benzene-1,4-diol (PubChem CID 141276702) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is 2-tert-butyl-5-(2-ethyl-3,3-dimethylbutyl)benzene-1,4-diol.
| Compound Name | 2-tert-butyl-5-(2-ethyl-3,3-dimethylbutyl)benzene-1,4-diol |
|---|---|
| PubChem CID | 141276702 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 2-tert-butyl-5-(2-ethyl-3,3-dimethylbutyl)benzene-1,4-diol |
| SMILES | CCC(Cc1cc(O)c(C(C)(C)C)cc1O)C(C)(C)C |
| InChI | InChI=1S/C18H30O2/c1-8-13(17(2,3)4)9-12-10-16(20)14(11-15(12)19)18(5,6)7/h10-11,13,19-20H,8-9H2,1-7H3 |
| InChIKey | BUGLMKUOCXATCD-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|