C18H28O4 — CID 139928552
(4-tert-butyl-2,5-dihydroxyphenyl)methyl 5-methylhexanoate (PubChem CID 139928552) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is (4-tert-butyl-2,5-dihydroxyphenyl)methyl 5-methylhexanoate.
| Compound Name | (4-tert-butyl-2,5-dihydroxyphenyl)methyl 5-methylhexanoate |
|---|---|
| PubChem CID | 139928552 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | (4-tert-butyl-2,5-dihydroxyphenyl)methyl 5-methylhexanoate |
| SMILES | CC(C)CCCC(=O)OCc1cc(O)c(C(C)(C)C)cc1O |
| InChI | InChI=1S/C18H28O4/c1-12(2)7-6-8-17(21)22-11-13-9-16(20)14(10-15(13)19)18(3,4)5/h9-10,12,19-20H,6-8,11H2,1-5H3 |
| InChIKey | NRDHFDVXCOGNGA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|