C27H44O6 — CID 88727908
hexyl 6-[2,5-dihydroxy-4-(6-methoxy-2-methyl-6-oxohexan-2-yl)phenyl]-5-methylhexanoate (PubChem CID 88727908) has the molecular formula C27H44O6 and a molecular weight of 464.64 g/mol. Its IUPAC name is hexyl 6-[2,5-dihydroxy-4-(6-methoxy-2-methyl-6-oxohexan-2-yl)phenyl]-5-methylhexanoate.
| Compound Name | hexyl 6-[2,5-dihydroxy-4-(6-methoxy-2-methyl-6-oxohexan-2-yl)phenyl]-5-methylhexanoate |
|---|---|
| PubChem CID | 88727908 |
| Molecular Formula | C27H44O6 |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.31 |
| IUPAC Name | hexyl 6-[2,5-dihydroxy-4-(6-methoxy-2-methyl-6-oxohexan-2-yl)phenyl]-5-methylhexanoate |
| SMILES | CCCCCCOC(=O)CCCC(C)Cc1cc(O)c(C(C)(C)CCCC(=O)OC)cc1O |
| InChI | InChI=1S/C27H44O6/c1-6-7-8-9-16-33-26(31)13-10-12-20(2)17-21-18-24(29)22(19-23(21)28)27(3,4)15-11-14-25(30)32-5/h18-20,28-29H,6-17H2,1-5H3 |
| InChIKey | OEHPTGJXJWFUCB-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|