C30H50O6 — CID 58625688
hexyl 3-[4-(5-hexylperoxy-2-methylhex-5-en-2-yl)-2,5-dihydroxyphenyl]-3-methylbutanoate (PubChem CID 58625688) has the molecular formula C30H50O6 and a molecular weight of 506.72 g/mol. Its IUPAC name is hexyl 3-[4-(5-hexylperoxy-2-methylhex-5-en-2-yl)-2,5-dihydroxyphenyl]-3-methylbutanoate.
| Compound Name | hexyl 3-[4-(5-hexylperoxy-2-methylhex-5-en-2-yl)-2,5-dihydroxyphenyl]-3-methylbutanoate |
|---|---|
| PubChem CID | 58625688 |
| Molecular Formula | C30H50O6 |
| Molecular Weight | 506.72 g/mol |
| Exact Mass | 506.36 |
| IUPAC Name | hexyl 3-[4-(5-hexylperoxy-2-methylhex-5-en-2-yl)-2,5-dihydroxyphenyl]-3-methylbutanoate |
| SMILES | C=C(CCC(C)(C)c1cc(O)c(C(C)(C)CC(=O)OCCCCCC)cc1O)OOCCCCCC |
| InChI | InChI=1S/C30H50O6/c1-8-10-12-14-18-34-28(33)22-30(6,7)25-21-26(31)24(20-27(25)32)29(4,5)17-16-23(3)36-35-19-15-13-11-9-2/h20-21,31-32H,3,8-19,22H2,1-2,4-7H3 |
| InChIKey | KNZHOFGUSRMAQV-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.72 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|