C32H42O6 — CID 20582401
hexyl 5-[4-(6-hexa-1,3,5-triynoxy-2-methyl-6-oxohexan-2-yl)-2,5-dihydroxyphenyl]-5-methylhexanoate (PubChem CID 20582401) has the molecular formula C32H42O6 and a molecular weight of 522.68 g/mol. Its IUPAC name is hexyl 5-[4-(6-hexa-1,3,5-triynoxy-2-methyl-6-oxohexan-2-yl)-2,5-dihydroxyphenyl]-5-methylhexanoate.
| Compound Name | hexyl 5-[4-(6-hexa-1,3,5-triynoxy-2-methyl-6-oxohexan-2-yl)-2,5-dihydroxyphenyl]-5-methylhexanoate |
|---|---|
| PubChem CID | 20582401 |
| Molecular Formula | C32H42O6 |
| Molecular Weight | 522.68 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | hexyl 5-[4-(6-hexa-1,3,5-triynoxy-2-methyl-6-oxohexan-2-yl)-2,5-dihydroxyphenyl]-5-methylhexanoate |
| SMILES | C#CC#CC#COC(=O)CCCC(C)(C)c1cc(O)c(C(C)(C)CCCC(=O)OCCCCCC)cc1O |
| InChI | InChI=1S/C32H42O6/c1-7-9-11-13-21-37-29(35)17-15-19-31(3,4)25-23-28(34)26(24-27(25)33)32(5,6)20-16-18-30(36)38-22-14-12-10-8-2/h1,23-24,33-34H,8,10,12,14-20,22H2,2-6H3 |
| InChIKey | PVWUIODAXFBWHT-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.68 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|