C24H37NOSi — CID 19971859
4-[1-[(4-aminophenyl)-dimethylsilyl]ethyl]-2,6-ditert-butylphenol (PubChem CID 19971859) has the molecular formula C24H37NOSi and a molecular weight of 383.65 g/mol. Its IUPAC name is 4-[1-[(4-aminophenyl)-dimethylsilyl]ethyl]-2,6-ditert-butylphenol.
| Compound Name | 4-[1-[(4-aminophenyl)-dimethylsilyl]ethyl]-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 19971859 |
| Molecular Formula | C24H37NOSi |
| Molecular Weight | 383.65 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | 4-[1-[(4-aminophenyl)-dimethylsilyl]ethyl]-2,6-ditert-butylphenol |
| SMILES | CC(c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)[Si](C)(C)c1ccc(N)cc1 |
| InChI | InChI=1S/C24H37NOSi/c1-16(27(8,9)19-12-10-18(25)11-13-19)17-14-20(23(2,3)4)22(26)21(15-17)24(5,6)7/h10-16,26H,25H2,1-9H3 |
| InChIKey | OLTAHYFCEFEKAS-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.65 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|