C27H39NO2S — CID 5017036
2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propylsulfanyl]-N-(4-ethylphenyl)acetamide (PubChem CID 5017036) has the molecular formula C27H39NO2S and a molecular weight of 441.68 g/mol. Its IUPAC name is 2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propylsulfanyl]-N-(4-ethylphenyl)acetamide.
| Compound Name | 2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propylsulfanyl]-N-(4-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 5017036 |
| Molecular Formula | C27H39NO2S |
| Molecular Weight | 441.68 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | 2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propylsulfanyl]-N-(4-ethylphenyl)acetamide |
| SMILES | CCc1ccc(NC(=O)CSCCCc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C27H39NO2S/c1-8-19-11-13-21(14-12-19)28-24(29)18-31-15-9-10-20-16-22(26(2,3)4)25(30)23(17-20)27(5,6)7/h11-14,16-17,30H,8-10,15,18H2,1-7H3,(H,28,29) |
| InChIKey | DGAAWLYXSDXDQI-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.68 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|