About bis[4-(dimethylamino)phenyl]-(9-ethylcarbazol-1-yl)methanol;methoxymethane
bis[4-(dimethylamino)phenyl]-(9-ethylcarbazol-1-yl)methanol;methoxymethane (PubChem CID 70415000) has the molecular formula C33H39N3O2
and a molecular weight of 509.69 g/mol. Its IUPAC name is bis[4-(dimethylamino)phenyl]-(9-ethylcarbazol-1-yl)methanol;methoxymethane.
Molecular Properties
| Compound Name | bis[4-(dimethylamino)phenyl]-(9-ethylcarbazol-1-yl)methanol;methoxymethane |
| PubChem CID | 70415000 |
| Molecular Formula | C33H39N3O2 |
| Molecular Weight | 509.69 g/mol |
| Exact Mass | 509.30 |
| IUPAC Name | bis[4-(dimethylamino)phenyl]-(9-ethylcarbazol-1-yl)methanol;methoxymethane |
| SMILES | CCn1c2ccccc2c2cccc(C(O)(c3ccc(N(C)C)cc3)c3ccc(N(C)C)cc3)c21.COC |
| InChI | InChI=1S/C31H33N3O.C2H6O/c1-6-34-29-13-8-7-10-26(29)27-11-9-12-28(30(27)34)31(35,22-14-18-24(19-15-22)32(2)3)23-16-20-25(21-17-23)33(4)5;1-3-2/h7-21,35H,6H2,1-5H3;1-2H3 |
| InChIKey | QRVZOXCHIAWUKE-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 40.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 509.69 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze bis[4-(dimethylamino)phenyl]-(9-ethylcarbazol-1-yl)methanol;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[4-(dimethylamino)phenyl]-(9-ethylcarbazol-1-yl)methanol;methoxymethane?
The IUPAC name of bis[4-(dimethylamino)phenyl]-(9-ethylcarbazol-1-yl)methanol;methoxymethane (CID 70415000) is bis[4-(dimethylamino)phenyl]-(9-ethylcarbazol-1-yl)methanol;methoxymethane.
What is the SMILES notation for bis[4-(dimethylamino)phenyl]-(9-ethylcarbazol-1-yl)methanol;methoxymethane?
The canonical SMILES for bis[4-(dimethylamino)phenyl]-(9-ethylcarbazol-1-yl)methanol;methoxymethane is CCn1c2ccccc2c2cccc(C(O)(c3ccc(N(C)C)cc3)c3ccc(N(C)C)cc3)c21.COC.
What is the InChIKey of bis[4-(dimethylamino)phenyl]-(9-ethylcarbazol-1-yl)methanol;methoxymethane?
The InChIKey is QRVZOXCHIAWUKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H33N3O.C2H6O/c1-6-34-29-13-8-7-10-26(29)27-11-9-12-28(30(27)34)31(35,22-14-18-24(19-15-22)32(2)3)23-16-20-25(21-17-23)33(4)5;1-3-2/h7-21,35H,6H2,1-5H3;1-2H3.
What are the key properties of bis[4-(dimethylamino)phenyl]-(9-ethylcarbazol-1-yl)methanol;methoxymethane?
bis[4-(dimethylamino)phenyl]-(9-ethylcarbazol-1-yl)methanol;methoxymethane has a molecular weight of 509.69 g/mol, XLogP of 6.49, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis[4-(dimethylamino)phenyl]-(9-ethylcarbazol-1-yl)methanol;methoxymethane is sourced from PubChem (CID 70415000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).