C17H18N2O — CID 163964567
9-ethyl-N,N-dimethylcarbazole-3-carboxamide (PubChem CID 163964567) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is 9-ethyl-N,N-dimethylcarbazole-3-carboxamide.
| Compound Name | 9-ethyl-N,N-dimethylcarbazole-3-carboxamide |
|---|---|
| PubChem CID | 163964567 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 9-ethyl-N,N-dimethylcarbazole-3-carboxamide |
| SMILES | CCn1c2ccccc2c2cc(C(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C17H18N2O/c1-4-19-15-8-6-5-7-13(15)14-11-12(9-10-16(14)19)17(20)18(2)3/h5-11H,4H2,1-3H3 |
| InChIKey | SKNKFQCPIRSMPC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |