C30H57OP — CID 140735561
tetrabutyl-(2,6-ditert-butylphenoxy)-λ5-phosphane (PubChem CID 140735561) has the molecular formula C30H57OP and a molecular weight of 464.76 g/mol. Its IUPAC name is tetrabutyl-(2,6-ditert-butylphenoxy)-λ5-phosphane.
| Compound Name | tetrabutyl-(2,6-ditert-butylphenoxy)-λ5-phosphane |
|---|---|
| PubChem CID | 140735561 |
| Molecular Formula | C30H57OP |
| Molecular Weight | 464.76 g/mol |
| Exact Mass | 464.41 |
| IUPAC Name | tetrabutyl-(2,6-ditert-butylphenoxy)-λ5-phosphane |
| SMILES | CCCCP(CCCC)(CCCC)(CCCC)Oc1c(C(C)(C)C)cccc1C(C)(C)C |
| InChI | InChI=1S/C30H57OP/c1-11-15-22-32(23-16-12-2,24-17-13-3,25-18-14-4)31-28-26(29(5,6)7)20-19-21-27(28)30(8,9)10/h19-21H,11-18,22-25H2,1-10H3 |
| InChIKey | IRTICYQEAHHGOG-UHFFFAOYSA-N |
| XLogP | 10.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.76 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|