C32H51AlO3 — CID 141314384
butoxy-bis(2,6-ditert-butylphenoxy)alumane (PubChem CID 141314384) has the molecular formula C32H51AlO3 and a molecular weight of 510.74 g/mol. Its IUPAC name is butoxy-bis(2,6-ditert-butylphenoxy)alumane.
| Compound Name | butoxy-bis(2,6-ditert-butylphenoxy)alumane |
|---|---|
| PubChem CID | 141314384 |
| Molecular Formula | C32H51AlO3 |
| Molecular Weight | 510.74 g/mol |
| Exact Mass | 510.37 |
| IUPAC Name | butoxy-bis(2,6-ditert-butylphenoxy)alumane |
| SMILES | CCCCO[Al](Oc1c(C(C)(C)C)cccc1C(C)(C)C)Oc1c(C(C)(C)C)cccc1C(C)(C)C |
| InChI | InChI=1S/2C14H22O.C4H9O.Al/c2*1-13(2,3)10-8-7-9-11(12(10)15)14(4,5)6;1-2-3-4-5;/h2*7-9,15H,1-6H3;2-4H2,1H3;/q;;-1;+3/p-2 |
| InChIKey | DMKBSTMOQZJTBV-UHFFFAOYSA-L |
| XLogP | 9.14 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.74 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|