C17H22O3S — CID 58734536
7-methyl-2,4-di(propan-2-yl)naphthalene-1-sulfonic acid (PubChem CID 58734536) has the molecular formula C17H22O3S and a molecular weight of 306.43 g/mol. Its IUPAC name is 7-methyl-2,4-di(propan-2-yl)naphthalene-1-sulfonic acid.
| Compound Name | 7-methyl-2,4-di(propan-2-yl)naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 58734536 |
| Molecular Formula | C17H22O3S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 7-methyl-2,4-di(propan-2-yl)naphthalene-1-sulfonic acid |
| SMILES | Cc1ccc2c(C(C)C)cc(C(C)C)c(S(=O)(=O)O)c2c1 |
| InChI | InChI=1S/C17H22O3S/c1-10(2)14-9-15(11(3)4)17(21(18,19)20)16-8-12(5)6-7-13(14)16/h6-11H,1-5H3,(H,18,19,20) |
| InChIKey | RDSAQHOOKOVKJA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|