C20H30N2 — CID 82448776
N-[(2-tert-butyl-6,7-dimethylquinolin-4-yl)methyl]butan-1-amine (PubChem CID 82448776) has the molecular formula C20H30N2 and a molecular weight of 298.47 g/mol. Its IUPAC name is N-[(2-tert-butyl-6,7-dimethylquinolin-4-yl)methyl]butan-1-amine.
| Compound Name | N-[(2-tert-butyl-6,7-dimethylquinolin-4-yl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 82448776 |
| Molecular Formula | C20H30N2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | N-[(2-tert-butyl-6,7-dimethylquinolin-4-yl)methyl]butan-1-amine |
| SMILES | CCCCNCc1cc(C(C)(C)C)nc2cc(C)c(C)cc12 |
| InChI | InChI=1S/C20H30N2/c1-7-8-9-21-13-16-12-19(20(4,5)6)22-18-11-15(3)14(2)10-17(16)18/h10-12,21H,7-9,13H2,1-6H3 |
| InChIKey | PIWXIYDRSCUIRA-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|