C19H28N2O — CID 82448681
N-[(2-tert-butyl-5,7-dimethylquinolin-4-yl)methyl]-2-methoxyethanamine (PubChem CID 82448681) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is N-[(2-tert-butyl-5,7-dimethylquinolin-4-yl)methyl]-2-methoxyethanamine.
| Compound Name | N-[(2-tert-butyl-5,7-dimethylquinolin-4-yl)methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 82448681 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | N-[(2-tert-butyl-5,7-dimethylquinolin-4-yl)methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1cc(C(C)(C)C)nc2cc(C)cc(C)c12 |
| InChI | InChI=1S/C19H28N2O/c1-13-9-14(2)18-15(12-20-7-8-22-6)11-17(19(3,4)5)21-16(18)10-13/h9-11,20H,7-8,12H2,1-6H3 |
| InChIKey | BHWBTBKPJNAABB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|