C15H24O2 — CID 174880154
2,3-dimethyl-3-(2,4,6-trimethylphenoxy)butan-2-ol (PubChem CID 174880154) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is 2,3-dimethyl-3-(2,4,6-trimethylphenoxy)butan-2-ol.
| Compound Name | 2,3-dimethyl-3-(2,4,6-trimethylphenoxy)butan-2-ol |
|---|---|
| PubChem CID | 174880154 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 2,3-dimethyl-3-(2,4,6-trimethylphenoxy)butan-2-ol |
| SMILES | Cc1cc(C)c(OC(C)(C)C(C)(C)O)c(C)c1 |
| InChI | InChI=1S/C15H24O2/c1-10-8-11(2)13(12(3)9-10)17-15(6,7)14(4,5)16/h8-9,16H,1-7H3 |
| InChIKey | BGEWSWRWKJXIBG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |