C10H12Cl2O — CID 130033487
3-tert-butyl-2,6-dichlorophenol (PubChem CID 130033487) has the molecular formula C10H12Cl2O and a molecular weight of 219.11 g/mol. Its IUPAC name is 3-tert-butyl-2,6-dichlorophenol.
| Compound Name | 3-tert-butyl-2,6-dichlorophenol |
|---|---|
| PubChem CID | 130033487 |
| Molecular Formula | C10H12Cl2O |
| Molecular Weight | 219.11 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 3-tert-butyl-2,6-dichlorophenol |
| SMILES | CC(C)(C)c1ccc(Cl)c(O)c1Cl |
| InChI | InChI=1S/C10H12Cl2O/c1-10(2,3)6-4-5-7(11)9(13)8(6)12/h4-5,13H,1-3H3 |
| InChIKey | FVWUXXZTBRZIIC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.11 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |