C13H17Cl3O — CID 174450533
1-tert-butyl-2,3,4-trichlorobenzene;propan-2-one (PubChem CID 174450533) has the molecular formula C13H17Cl3O and a molecular weight of 295.64 g/mol. Its IUPAC name is 1-tert-butyl-2,3,4-trichlorobenzene;propan-2-one.
| Compound Name | 1-tert-butyl-2,3,4-trichlorobenzene;propan-2-one |
|---|---|
| PubChem CID | 174450533 |
| Molecular Formula | C13H17Cl3O |
| Molecular Weight | 295.64 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 1-tert-butyl-2,3,4-trichlorobenzene;propan-2-one |
| SMILES | CC(C)(C)c1ccc(Cl)c(Cl)c1Cl.CC(C)=O |
| InChI | InChI=1S/C10H11Cl3.C3H6O/c1-10(2,3)6-4-5-7(11)9(13)8(6)12;1-3(2)4/h4-5H,1-3H3;1-2H3 |
| InChIKey | WCKBDQCUEJFBSE-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.64 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|