C18H28N2O2 — CID 137015289
(2S)-2-[(3-tert-butyl-2-hydroxyphenyl)methylideneamino]-N,N,3-trimethylbutanamide (PubChem CID 137015289) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is (2S)-2-[(3-tert-butyl-2-hydroxyphenyl)methylideneamino]-N,N,3-trimethylbutanamide.
| Compound Name | (2S)-2-[(3-tert-butyl-2-hydroxyphenyl)methylideneamino]-N,N,3-trimethylbutanamide |
|---|---|
| PubChem CID | 137015289 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | (2S)-2-[(3-tert-butyl-2-hydroxyphenyl)methylideneamino]-N,N,3-trimethylbutanamide |
| SMILES | CC(C)[C@H](/N=C/c1cccc(C(C)(C)C)c1O)C(=O)N(C)C |
| InChI | InChI=1S/C18H28N2O2/c1-12(2)15(17(22)20(6)7)19-11-13-9-8-10-14(16(13)21)18(3,4)5/h8-12,15,21H,1-7H3/b19-11+/t15-/m0/s1 |
| InChIKey | MQPPHVPWVSRDPO-BKQORJHRSA-N |
| XLogP | 3.22 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|