C23H27FeNO2+2 — CID 135424866
CID 135424866 (PubChem CID 135424866) has the molecular formula C23H27FeNO2+2 and a molecular weight of 405.32 g/mol.
| Compound Name | CID 135424866 |
|---|---|
| PubChem CID | 135424866 |
| Molecular Formula | C23H27FeNO2+2 |
| Molecular Weight | 405.32 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cccc(/C=N/[C@@H](CO)[C]2[CH][CH][CH][CH]2)c1O.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C18H22NO2.C5H5.Fe/c1-18(2,3)15-10-6-9-14(17(15)21)11-19-16(12-20)13-7-4-5-8-13;1-2-4-5-3-1;/h4-11,16,20-21H,12H2,1-3H3;1-5H;/q;;+2/b19-11+;;/t16-;;/m0../s1 |
| InChIKey | BGDAEHGOLKLKSR-HJAYNANNSA-N |
| XLogP | 3.89 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.32 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|