C27H31NO — CID 142139974
2-[1,2-bis(2,4,6-trimethylphenyl)ethyliminomethyl]phenol (PubChem CID 142139974) has the molecular formula C27H31NO and a molecular weight of 385.55 g/mol. Its IUPAC name is 2-[1,2-bis(2,4,6-trimethylphenyl)ethyliminomethyl]phenol.
| Compound Name | 2-[1,2-bis(2,4,6-trimethylphenyl)ethyliminomethyl]phenol |
|---|---|
| PubChem CID | 142139974 |
| Molecular Formula | C27H31NO |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | 2-[1,2-bis(2,4,6-trimethylphenyl)ethyliminomethyl]phenol |
| SMILES | Cc1cc(C)c(CC(/N=C/c2ccccc2O)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C27H31NO/c1-17-11-19(3)24(20(4)12-17)15-25(27-21(5)13-18(2)14-22(27)6)28-16-23-9-7-8-10-26(23)29/h7-14,16,25,29H,15H2,1-6H3/b28-16+ |
| InChIKey | QRSDIBGWDGFAMT-LQKURTRISA-N |
| XLogP | 6.65 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|