C21H27NO5S — CID 154377782
3-[(3,5-ditert-butyl-4-hydroxybenzoyl)amino]benzenesulfonic acid (PubChem CID 154377782) has the molecular formula C21H27NO5S and a molecular weight of 405.52 g/mol. Its IUPAC name is 3-[(3,5-ditert-butyl-4-hydroxybenzoyl)amino]benzenesulfonic acid.
| Compound Name | 3-[(3,5-ditert-butyl-4-hydroxybenzoyl)amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 154377782 |
| Molecular Formula | C21H27NO5S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 3-[(3,5-ditert-butyl-4-hydroxybenzoyl)amino]benzenesulfonic acid |
| SMILES | CC(C)(C)c1cc(C(=O)Nc2cccc(S(=O)(=O)O)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C21H27NO5S/c1-20(2,3)16-10-13(11-17(18(16)23)21(4,5)6)19(24)22-14-8-7-9-15(12-14)28(25,26)27/h7-12,23H,1-6H3,(H,22,24)(H,25,26,27) |
| InChIKey | VPPDESQGXQPHAM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|