C23H31NO4S — CID 143456747
3-[[4-(2,2,5,5-tetramethylhexan-3-yl)benzoyl]amino]benzenesulfonic acid (PubChem CID 143456747) has the molecular formula C23H31NO4S and a molecular weight of 417.57 g/mol. Its IUPAC name is 3-[[4-(2,2,5,5-tetramethylhexan-3-yl)benzoyl]amino]benzenesulfonic acid.
| Compound Name | 3-[[4-(2,2,5,5-tetramethylhexan-3-yl)benzoyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 143456747 |
| Molecular Formula | C23H31NO4S |
| Molecular Weight | 417.57 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | 3-[[4-(2,2,5,5-tetramethylhexan-3-yl)benzoyl]amino]benzenesulfonic acid |
| SMILES | CC(C)(C)CC(c1ccc(C(=O)Nc2cccc(S(=O)(=O)O)c2)cc1)C(C)(C)C |
| InChI | InChI=1S/C23H31NO4S/c1-22(2,3)15-20(23(4,5)6)16-10-12-17(13-11-16)21(25)24-18-8-7-9-19(14-18)29(26,27)28/h7-14,20H,15H2,1-6H3,(H,24,25)(H,26,27,28) |
| InChIKey | HTGWMHQJPKDEOP-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.57 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|