C21H34LiOP — CID 141023172
lithium [3-oxo-3-(2,4,6-tritert-butylphenyl)propyl]phosphanide (PubChem CID 141023172) has the molecular formula C21H34LiOP and a molecular weight of 340.42 g/mol. Its IUPAC name is lithium [3-oxo-3-(2,4,6-tritert-butylphenyl)propyl]phosphanide.
| Compound Name | lithium [3-oxo-3-(2,4,6-tritert-butylphenyl)propyl]phosphanide |
|---|---|
| PubChem CID | 141023172 |
| Molecular Formula | C21H34LiOP |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | lithium [3-oxo-3-(2,4,6-tritert-butylphenyl)propyl]phosphanide |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(C(=O)CC[PH-])c(C(C)(C)C)c1.[Li+] |
| InChI | InChI=1S/C21H34OP.Li/c1-19(2,3)14-12-15(20(4,5)6)18(17(22)10-11-23)16(13-14)21(7,8)9;/h12-13,23H,10-11H2,1-9H3;/q-1;+1 |
| InChIKey | FNWYRNBTBAPECF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|