C9H5Cl5LiOP — CID 141022977
lithium [3-oxo-3-(2,3,4,5,6-pentachlorophenyl)propyl]phosphanide (PubChem CID 141022977) has the molecular formula C9H5Cl5LiOP and a molecular weight of 344.32 g/mol. Its IUPAC name is lithium [3-oxo-3-(2,3,4,5,6-pentachlorophenyl)propyl]phosphanide.
| Compound Name | lithium [3-oxo-3-(2,3,4,5,6-pentachlorophenyl)propyl]phosphanide |
|---|---|
| PubChem CID | 141022977 |
| Molecular Formula | C9H5Cl5LiOP |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 341.87 |
| IUPAC Name | lithium [3-oxo-3-(2,3,4,5,6-pentachlorophenyl)propyl]phosphanide |
| SMILES | O=C(CC[PH-])c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl.[Li+] |
| InChI | InChI=1S/C9H5Cl5OP.Li/c10-5-4(3(15)1-2-16)6(11)8(13)9(14)7(5)12;/h16H,1-2H2;/q-1;+1 |
| InChIKey | HAZYMSRZQPPULS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|