C17H17Cl2LiO2P+ — CID 18514138
lithium (2,6-dichlorophenyl)-[4-[(2-methylpropan-2-yl)oxy]phenyl]phosphanylmethanone (PubChem CID 18514138) has the molecular formula C17H17Cl2LiO2P+ and a molecular weight of 362.14 g/mol. Its IUPAC name is lithium (2,6-dichlorophenyl)-[4-[(2-methylpropan-2-yl)oxy]phenyl]phosphanylmethanone.
| Compound Name | lithium (2,6-dichlorophenyl)-[4-[(2-methylpropan-2-yl)oxy]phenyl]phosphanylmethanone |
|---|---|
| PubChem CID | 18514138 |
| Molecular Formula | C17H17Cl2LiO2P+ |
| Molecular Weight | 362.14 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | lithium (2,6-dichlorophenyl)-[4-[(2-methylpropan-2-yl)oxy]phenyl]phosphanylmethanone |
| SMILES | CC(C)(C)Oc1ccc(PC(=O)c2c(Cl)cccc2Cl)cc1.[Li+] |
| InChI | InChI=1S/C17H17Cl2O2P.Li/c1-17(2,3)21-11-7-9-12(10-8-11)22-16(20)15-13(18)5-4-6-14(15)19;/h4-10,22H,1-3H3;/q;+1 |
| InChIKey | QMAAYBNJOBAQDN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.14 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|