C34H53LiO4P — CID 70016889
CID 70016889 (PubChem CID 70016889) has the molecular formula C34H53LiO4P and a molecular weight of 563.71 g/mol.
| Compound Name | CID 70016889 |
|---|---|
| PubChem CID | 70016889 |
| Molecular Formula | C34H53LiO4P |
| Molecular Weight | 563.71 g/mol |
| Exact Mass | 563.38 |
| IUPAC Name | — |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1C(=O)Pc1c(OCCC(C)C)cc(OCCC(C)C)cc1OCCC(C)C.[Li] |
| InChI | InChI=1S/C34H53O4P.Li/c1-22(2)12-15-36-28-20-29(37-16-13-23(3)4)32(30(21-28)38-17-14-24(5)6)39-33(35)31-25(7)18-27(19-26(31)8)34(9,10)11;/h18-24,39H,12-17H2,1-11H3; |
| InChIKey | BGMZFMRXVBBBGG-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.71 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|