C28H40O5P- — CID 141016809
4-[2,4,6-tris(3-methylbutoxy)phenyl]phosphanylcarbonylphenolate (PubChem CID 141016809) has the molecular formula C28H40O5P- and a molecular weight of 487.60 g/mol. Its IUPAC name is 4-[2,4,6-tris(3-methylbutoxy)phenyl]phosphanylcarbonylphenolate.
| Compound Name | 4-[2,4,6-tris(3-methylbutoxy)phenyl]phosphanylcarbonylphenolate |
|---|---|
| PubChem CID | 141016809 |
| Molecular Formula | C28H40O5P- |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | 4-[2,4,6-tris(3-methylbutoxy)phenyl]phosphanylcarbonylphenolate |
| SMILES | CC(C)CCOc1cc(OCCC(C)C)c(PC(=O)c2ccc([O-])cc2)c(OCCC(C)C)c1 |
| InChI | InChI=1S/C28H41O5P/c1-19(2)11-14-31-24-17-25(32-15-12-20(3)4)27(26(18-24)33-16-13-21(5)6)34-28(30)22-7-9-23(29)10-8-22/h7-10,17-21,29,34H,11-16H2,1-6H3/p-1 |
| InChIKey | IOCSOZOBWYNWCI-UHFFFAOYSA-M |
| XLogP | 6.18 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|