C36H54N4O5P+ — CID 158989096
(2,4-dipentoxyphenyl)-oxophosphanium;bis(2,4,6-trimethylbenzohydrazide) (PubChem CID 158989096) has the molecular formula C36H54N4O5P+ and a molecular weight of 653.83 g/mol. Its IUPAC name is (2,4-dipentoxyphenyl)-oxophosphanium;bis(2,4,6-trimethylbenzohydrazide).
| Compound Name | (2,4-dipentoxyphenyl)-oxophosphanium;bis(2,4,6-trimethylbenzohydrazide) |
|---|---|
| PubChem CID | 158989096 |
| Molecular Formula | C36H54N4O5P+ |
| Molecular Weight | 653.83 g/mol |
| Exact Mass | 653.38 |
| IUPAC Name | (2,4-dipentoxyphenyl)-oxophosphanium;bis(2,4,6-trimethylbenzohydrazide) |
| SMILES | CCCCCOc1ccc([PH+]=O)c(OCCCCC)c1.Cc1cc(C)c(C(=O)NN)c(C)c1.Cc1cc(C)c(C(=O)NN)c(C)c1 |
| InChI | InChI=1S/C16H25O3P.2C10H14N2O/c1-3-5-7-11-18-14-9-10-16(20-17)15(13-14)19-12-8-6-4-2;2*1-6-4-7(2)9(8(3)5-6)10(13)12-11/h9-10,13H,3-8,11-12H2,1-2H3;2*4-5H,11H2,1-3H3,(H,12,13)/p+1 |
| InChIKey | JPYDHRLIFYMCLX-UHFFFAOYSA-O |
| XLogP | 6.90 |
| TPSA | 145.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.83 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|