C26H32NOP — CID 45379872
(1S)-N-[tert-butyl(phenyl)phosphoryl]-1-phenyl-1-(2,4,6-trimethylphenyl)methanamine (PubChem CID 45379872) has the molecular formula C26H32NOP and a molecular weight of 405.52 g/mol. Its IUPAC name is (1S)-N-[tert-butyl(phenyl)phosphoryl]-1-phenyl-1-(2,4,6-trimethylphenyl)methanamine.
| Compound Name | (1S)-N-[tert-butyl(phenyl)phosphoryl]-1-phenyl-1-(2,4,6-trimethylphenyl)methanamine |
|---|---|
| PubChem CID | 45379872 |
| Molecular Formula | C26H32NOP |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | (1S)-N-[tert-butyl(phenyl)phosphoryl]-1-phenyl-1-(2,4,6-trimethylphenyl)methanamine |
| SMILES | Cc1cc(C)c([C@@H](N[P@](=O)(c2ccccc2)C(C)(C)C)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C26H32NOP/c1-19-17-20(2)24(21(3)18-19)25(22-13-9-7-10-14-22)27-29(28,26(4,5)6)23-15-11-8-12-16-23/h7-18,25H,1-6H3,(H,27,28)/t25-,29-/m0/s1 |
| InChIKey | DNQXAXAIKIQPOY-SVEHJYQDSA-N |
| XLogP | 6.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|