C21H28NOP — CID 45379873
(1R)-N-[tert-butyl(phenyl)phosphoryl]-3-methyl-1-phenylbut-3-en-1-amine (PubChem CID 45379873) has the molecular formula C21H28NOP and a molecular weight of 341.44 g/mol. Its IUPAC name is (1R)-N-[tert-butyl(phenyl)phosphoryl]-3-methyl-1-phenylbut-3-en-1-amine.
| Compound Name | (1R)-N-[tert-butyl(phenyl)phosphoryl]-3-methyl-1-phenylbut-3-en-1-amine |
|---|---|
| PubChem CID | 45379873 |
| Molecular Formula | C21H28NOP |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | (1R)-N-[tert-butyl(phenyl)phosphoryl]-3-methyl-1-phenylbut-3-en-1-amine |
| SMILES | C=C(C)C[C@@H](N[P@](=O)(c1ccccc1)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C21H28NOP/c1-17(2)16-20(18-12-8-6-9-13-18)22-24(23,21(3,4)5)19-14-10-7-11-15-19/h6-15,20H,1,16H2,2-5H3,(H,22,23)/t20-,24+/m1/s1 |
| InChIKey | YESMMMJNSIJGPC-YKSBVNFPSA-N |
| XLogP | 5.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|