C23H23O2P — CID 118481550
2-diphenylphosphoryl-2-(2,4,6-trimethylphenyl)acetaldehyde (PubChem CID 118481550) has the molecular formula C23H23O2P and a molecular weight of 362.41 g/mol. Its IUPAC name is 2-diphenylphosphoryl-2-(2,4,6-trimethylphenyl)acetaldehyde.
| Compound Name | 2-diphenylphosphoryl-2-(2,4,6-trimethylphenyl)acetaldehyde |
|---|---|
| PubChem CID | 118481550 |
| Molecular Formula | C23H23O2P |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 2-diphenylphosphoryl-2-(2,4,6-trimethylphenyl)acetaldehyde |
| SMILES | Cc1cc(C)c(C(C=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C23H23O2P/c1-17-14-18(2)23(19(3)15-17)22(16-24)26(25,20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-16,22H,1-3H3 |
| InChIKey | DPNFVLFLBFSJKB-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|