C16H17NO3S — CID 87523505
2-pyridin-2-ylsulfonyl-2-(2,4,6-trimethylphenyl)acetaldehyde (PubChem CID 87523505) has the molecular formula C16H17NO3S and a molecular weight of 303.38 g/mol. Its IUPAC name is 2-pyridin-2-ylsulfonyl-2-(2,4,6-trimethylphenyl)acetaldehyde.
| Compound Name | 2-pyridin-2-ylsulfonyl-2-(2,4,6-trimethylphenyl)acetaldehyde |
|---|---|
| PubChem CID | 87523505 |
| Molecular Formula | C16H17NO3S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 2-pyridin-2-ylsulfonyl-2-(2,4,6-trimethylphenyl)acetaldehyde |
| SMILES | Cc1cc(C)c(C(C=O)S(=O)(=O)c2ccccn2)c(C)c1 |
| InChI | InChI=1S/C16H17NO3S/c1-11-8-12(2)16(13(3)9-11)14(10-18)21(19,20)15-6-4-5-7-17-15/h4-10,14H,1-3H3 |
| InChIKey | FAJBGSNPISPMBB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|