C17H20N2O4S — CID 94027199
(2S)-N-[2-(3-methylphenoxy)ethyl]-2-pyridin-2-ylsulfonylpropanamide (PubChem CID 94027199) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is (2S)-N-[2-(3-methylphenoxy)ethyl]-2-pyridin-2-ylsulfonylpropanamide.
| Compound Name | (2S)-N-[2-(3-methylphenoxy)ethyl]-2-pyridin-2-ylsulfonylpropanamide |
|---|---|
| PubChem CID | 94027199 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | (2S)-N-[2-(3-methylphenoxy)ethyl]-2-pyridin-2-ylsulfonylpropanamide |
| SMILES | Cc1cccc(OCCNC(=O)[C@H](C)S(=O)(=O)c2ccccn2)c1 |
| InChI | InChI=1S/C17H20N2O4S/c1-13-6-5-7-15(12-13)23-11-10-19-17(20)14(2)24(21,22)16-8-3-4-9-18-16/h3-9,12,14H,10-11H2,1-2H3,(H,19,20)/t14-/m0/s1 |
| InChIKey | XEAMABQEBIEPGV-AWEZNQCLSA-N |
| XLogP | 1.75 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|