C21H27NO3 — CID 133239821
N-[2-(3-methylphenoxy)ethyl]-2-(2,3,5-trimethylphenoxy)propanamide (PubChem CID 133239821) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is N-[2-(3-methylphenoxy)ethyl]-2-(2,3,5-trimethylphenoxy)propanamide.
| Compound Name | N-[2-(3-methylphenoxy)ethyl]-2-(2,3,5-trimethylphenoxy)propanamide |
|---|---|
| PubChem CID | 133239821 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | N-[2-(3-methylphenoxy)ethyl]-2-(2,3,5-trimethylphenoxy)propanamide |
| SMILES | Cc1cccc(OCCNC(=O)C(C)Oc2cc(C)cc(C)c2C)c1 |
| InChI | InChI=1S/C21H27NO3/c1-14-7-6-8-19(12-14)24-10-9-22-21(23)18(5)25-20-13-15(2)11-16(3)17(20)4/h6-8,11-13,18H,9-10H2,1-5H3,(H,22,23) |
| InChIKey | XNWUWOSTCOHFCB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|