C20H25NO4 — CID 133211011
N-[2-(3,4-dimethylphenoxy)ethyl]-2-(2-methoxyphenoxy)propanamide (PubChem CID 133211011) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is N-[2-(3,4-dimethylphenoxy)ethyl]-2-(2-methoxyphenoxy)propanamide.
| Compound Name | N-[2-(3,4-dimethylphenoxy)ethyl]-2-(2-methoxyphenoxy)propanamide |
|---|---|
| PubChem CID | 133211011 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | N-[2-(3,4-dimethylphenoxy)ethyl]-2-(2-methoxyphenoxy)propanamide |
| SMILES | COc1ccccc1OC(C)C(=O)NCCOc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C20H25NO4/c1-14-9-10-17(13-15(14)2)24-12-11-21-20(22)16(3)25-19-8-6-5-7-18(19)23-4/h5-10,13,16H,11-12H2,1-4H3,(H,21,22) |
| InChIKey | PIEHSVNJEZSVAO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|