C18H20ClNO4 — CID 92540063
(2S)-2-(4-chlorophenoxy)-N-[2-(2-methoxyphenoxy)ethyl]propanamide (PubChem CID 92540063) has the molecular formula C18H20ClNO4 and a molecular weight of 349.81 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenoxy)-N-[2-(2-methoxyphenoxy)ethyl]propanamide.
| Compound Name | (2S)-2-(4-chlorophenoxy)-N-[2-(2-methoxyphenoxy)ethyl]propanamide |
|---|---|
| PubChem CID | 92540063 |
| Molecular Formula | C18H20ClNO4 |
| Molecular Weight | 349.81 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | (2S)-2-(4-chlorophenoxy)-N-[2-(2-methoxyphenoxy)ethyl]propanamide |
| SMILES | COc1ccccc1OCCNC(=O)[C@H](C)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H20ClNO4/c1-13(24-15-9-7-14(19)8-10-15)18(21)20-11-12-23-17-6-4-3-5-16(17)22-2/h3-10,13H,11-12H2,1-2H3,(H,20,21)/t13-/m0/s1 |
| InChIKey | FLPXMLDYACPGOF-ZDUSSCGKSA-N |
| XLogP | 3.31 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.81 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|