C18H28O3 — CID 173267626
octan-2-yl 2,4,6-trimethylbenzenecarboperoxoate (PubChem CID 173267626) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is octan-2-yl 2,4,6-trimethylbenzenecarboperoxoate.
| Compound Name | octan-2-yl 2,4,6-trimethylbenzenecarboperoxoate |
|---|---|
| PubChem CID | 173267626 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | octan-2-yl 2,4,6-trimethylbenzenecarboperoxoate |
| SMILES | CCCCCCC(C)OOC(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C18H28O3/c1-6-7-8-9-10-16(5)20-21-18(19)17-14(3)11-13(2)12-15(17)4/h11-12,16H,6-10H2,1-5H3 |
| InChIKey | DAKRJYBNGJMPSO-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|